C33H34F2N8O2 — CID 174013605
2-amino-3-[1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide (PubChem CID 174013605) has the molecular formula C33H34F2N8O2 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-amino-3-[1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide.
| Compound Name | 2-amino-3-[1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174013605 |
| Molecular Formula | C33H34F2N8O2 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | 2-amino-3-[1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide |
| SMILES | NC(=O)C(N)=CC1=NCCCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(F)c45)ncc23)C1 |
| InChI | InChI=1S/C33H34F2N8O2/c34-24-9-2-7-20-6-1-8-22(26(20)24)28-27(35)29-23(17-39-28)31(42-13-5-12-38-21(18-42)16-25(36)30(37)44)41-32(40-29)45-19-33-10-3-14-43(33)15-4-11-33/h1-2,6-9,16-17H,3-5,10-15,18-19,36H2,(H2,37,44) |
| InChIKey | JMNUYGJAPUJEPD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|