C28H24F6N4O2 — CID 164534301
7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 164534301) has the molecular formula C28H24F6N4O2 and a molecular weight of 562.51 g/mol. Its IUPAC name is 7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164534301 |
| Molecular Formula | C28H24F6N4O2 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 7-[8-(difluoromethyl)naphthalen-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(-c2cccc3cccc(C(F)F)c23)ncc2c(OCC(F)(F)F)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C28H24F6N4O2/c29-21-22(17-7-1-5-16-6-2-8-18(20(16)17)24(30)31)35-13-19-23(21)36-26(37-25(19)39-15-28(32,33)34)40-14-27-9-3-11-38(27)12-4-10-27/h1-2,5-8,13,24H,3-4,9-12,14-15H2 |
| InChIKey | IZUPBKBACVPJCA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |