C27H26ClF5N6O — CID 172556376
7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-N-(1-bicyclo[1.1.1]pentanyl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 172556376) has the molecular formula C27H26ClF5N6O and a molecular weight of 580.99 g/mol. Its IUPAC name is 7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-N-(1-bicyclo[1.1.1]pentanyl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-N-(1-bicyclo[1.1.1]pentanyl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172556376 |
| Molecular Formula | C27H26ClF5N6O |
| Molecular Weight | 580.99 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-N-(1-bicyclo[1.1.1]pentanyl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Nc1cc(Cl)c(C(F)(F)F)c(-c2ncc3c(NC45CC(C4)C5)nc(OC[C@@]45CCCN4C[C@H](F)C5)nc3c2F)c1 |
| InChI | InChI=1S/C27H26ClF5N6O/c28-18-5-15(34)4-16(19(18)27(31,32)33)21-20(30)22-17(10-35-21)23(38-25-6-13(7-25)8-25)37-24(36-22)40-12-26-2-1-3-39(26)11-14(29)9-26/h4-5,10,13-14H,1-3,6-9,11-12,34H2,(H,36,37,38)/t13?,14-,25?,26+/m1/s1 |
| InChIKey | FZHKPKQUGKUMDN-OJUKWOTASA-N |
| XLogP | 6.00 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.99 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|