C32H32F4N6O — CID 171594680
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]quinazolin-7-yl]-5,6-difluoronaphthalen-2-amine (PubChem CID 171594680) has the molecular formula C32H32F4N6O and a molecular weight of 592.64 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]quinazolin-7-yl]-5,6-difluoronaphthalen-2-amine.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]quinazolin-7-yl]-5,6-difluoronaphthalen-2-amine |
|---|---|
| PubChem CID | 171594680 |
| Molecular Formula | C32H32F4N6O |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]quinazolin-7-yl]-5,6-difluoronaphthalen-2-amine |
| SMILES | Nc1cc(-c2ccc3c(N4CC5CCC(C4)N5)nc(OCC45CCCN4CC(F)C5)nc3c2F)c2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C32H32F4N6O/c33-18-12-32(8-1-9-42(32)13-18)16-43-31-39-29-23(30(40-31)41-14-20-3-4-21(15-41)38-20)6-5-22(27(29)35)24-11-19(37)10-17-2-7-25(34)28(36)26(17)24/h2,5-7,10-11,18,20-21,38H,1,3-4,8-9,12-16,37H2 |
| InChIKey | QSLHWIUYGSIWIT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|