C28H30ClF3N6O — CID 166522546
2-chloro-3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoroaniline (PubChem CID 166522546) has the molecular formula C28H30ClF3N6O and a molecular weight of 559.04 g/mol. Its IUPAC name is 2-chloro-3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoroaniline.
| Compound Name | 2-chloro-3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoroaniline |
|---|---|
| PubChem CID | 166522546 |
| Molecular Formula | C28H30ClF3N6O |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-chloro-3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(-c2ccc3c(N4C[C@H]5CC[C@@H](C4)N5)nc(OC[C@@]45CCCN4C[C@H](F)C5)nc3c2F)c1Cl |
| InChI | InChI=1S/C28H30ClF3N6O/c29-23-21(8-15(30)9-22(23)33)19-4-5-20-25(24(19)32)35-27(36-26(20)37-12-17-2-3-18(13-37)34-17)39-14-28-6-1-7-38(28)11-16(31)10-28/h4-5,8-9,16-18,34H,1-3,6-7,10-14,33H2/t16-,17-,18+,28+/m1/s1 |
| InChIKey | ZWUOGYOLSLABDC-DNSULAHJSA-N |
| XLogP | 4.71 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|