C28H29ClF3N5O2 — CID 171453912
2-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-3-fluorophenol (PubChem CID 171453912) has the molecular formula C28H29ClF3N5O2 and a molecular weight of 560.02 g/mol. Its IUPAC name is 2-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-3-fluorophenol.
| Compound Name | 2-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-3-fluorophenol |
|---|---|
| PubChem CID | 171453912 |
| Molecular Formula | C28H29ClF3N5O2 |
| Molecular Weight | 560.02 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 2-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-3-fluorophenol |
| SMILES | Oc1cccc(F)c1-c1c(Cl)cc2c(N3CC4CCC(C3)N4)nc(OC[C@@]34CCCN3C[C@H](F)C4)nc2c1F |
| InChI | InChI=1S/C28H29ClF3N5O2/c29-19-9-18-25(24(32)22(19)23-20(31)3-1-4-21(23)38)34-27(35-26(18)36-12-16-5-6-17(13-36)33-16)39-14-28-7-2-8-37(28)11-15(30)10-28/h1,3-4,9,15-17,33,38H,2,5-8,10-14H2/t15-,16?,17?,28+/m1/s1 |
| InChIKey | GVRFLRNXRAHFMX-OGBBLICMSA-N |
| XLogP | 4.83 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.02 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |