C35H36F3N5O2 — CID 170002477
5-cyclopropyl-4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]naphthalen-2-ol (PubChem CID 170002477) has the molecular formula C35H36F3N5O2 and a molecular weight of 615.70 g/mol. Its IUPAC name is 5-cyclopropyl-4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 5-cyclopropyl-4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 170002477 |
| Molecular Formula | C35H36F3N5O2 |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 5-cyclopropyl-4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2c(F)cc3c(N4CC5CCC(C4)N5)nc(OC[C@@]45CCCN4CC(F)C5)nc3c2F)c2c(C3CC3)cccc2c1 |
| InChI | InChI=1S/C35H36F3N5O2/c36-21-14-35(9-2-10-43(35)15-21)18-45-34-40-32-27(33(41-34)42-16-22-7-8-23(17-42)39-22)13-28(37)30(31(32)38)26-12-24(44)11-20-3-1-4-25(29(20)26)19-5-6-19/h1,3-4,11-13,19,21-23,39,44H,2,5-10,14-18H2/t21?,22?,23?,35-/m0/s1 |
| InChIKey | NYSSYBRMYZYUEA-QMAMVIIQSA-N |
| XLogP | 6.21 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |