C33H36F2N6O — CID 167399857
7-(4-cyclopropyl-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline (PubChem CID 167399857) has the molecular formula C33H36F2N6O and a molecular weight of 570.69 g/mol. Its IUPAC name is 7-(4-cyclopropyl-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline.
| Compound Name | 7-(4-cyclopropyl-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
|---|---|
| PubChem CID | 167399857 |
| Molecular Formula | C33H36F2N6O |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 7-(4-cyclopropyl-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
| SMILES | Fc1cc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OCC34CCCN3CCC4)nc2c(F)c1-c1c[nH]c2cccc(C3CC3)c12 |
| InChI | InChI=1S/C33H36F2N6O/c34-25-14-23-30(29(35)28(25)24-15-36-26-5-1-4-22(27(24)26)19-6-7-19)38-32(42-18-33-10-2-12-41(33)13-3-11-33)39-31(23)40-16-20-8-9-21(17-40)37-20/h1,4-5,14-15,19-21,36-37H,2-3,6-13,16-18H2/t20-,21+ |
| InChIKey | NROKBPVAJWPGGA-OYRHEFFESA-N |
| XLogP | 5.88 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |