C32H31Cl2F2N5O2 — CID 166929162
5-chloro-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoronaphthalen-2-ol (PubChem CID 166929162) has the molecular formula C32H31Cl2F2N5O2 and a molecular weight of 626.54 g/mol. Its IUPAC name is 5-chloro-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoronaphthalen-2-ol.
| Compound Name | 5-chloro-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 166929162 |
| Molecular Formula | C32H31Cl2F2N5O2 |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 5-chloro-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoronaphthalen-2-ol |
| SMILES | Oc1cc(-c2c(Cl)cc3c(N4CC5CCC(C4)N5)nc(OCC45CCCN4CCC5)nc3c2F)c2c(Cl)c(F)ccc2c1 |
| InChI | InChI=1S/C32H31Cl2F2N5O2/c33-23-13-22-29(28(36)26(23)21-12-20(42)11-17-3-6-24(35)27(34)25(17)21)38-31(43-16-32-7-1-9-41(32)10-2-8-32)39-30(22)40-14-18-4-5-19(15-40)37-18/h3,6,11-13,18-19,37,42H,1-2,4-5,7-10,14-16H2 |
| InChIKey | BZKWPIZATHLSEJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |