C30H30ClF3N6O — CID 167399998
7-(5-chloro-4-fluoro-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline (PubChem CID 167399998) has the molecular formula C30H30ClF3N6O and a molecular weight of 583.06 g/mol. Its IUPAC name is 7-(5-chloro-4-fluoro-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline.
| Compound Name | 7-(5-chloro-4-fluoro-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
|---|---|
| PubChem CID | 167399998 |
| Molecular Formula | C30H30ClF3N6O |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 7-(5-chloro-4-fluoro-1H-indol-3-yl)-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
| SMILES | Fc1cc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OCC34CCCN3CCC4)nc2c(F)c1-c1c[nH]c2ccc(Cl)c(F)c12 |
| InChI | InChI=1S/C30H30ClF3N6O/c31-20-5-6-22-24(25(20)33)19(12-35-22)23-21(32)11-18-27(26(23)34)37-29(41-15-30-7-1-9-40(30)10-2-8-30)38-28(18)39-13-16-3-4-17(14-39)36-16/h5-6,11-12,16-17,35-36H,1-4,7-10,13-15H2/t16-,17+ |
| InChIKey | MYOQTOCGOIPYQK-CALCHBBNSA-N |
| XLogP | 5.80 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |