C31H32F2N6O2 — CID 167400253
3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-1H-indole-4-carbaldehyde (PubChem CID 167400253) has the molecular formula C31H32F2N6O2 and a molecular weight of 558.63 g/mol. Its IUPAC name is 3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-1H-indole-4-carbaldehyde.
| Compound Name | 3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-1H-indole-4-carbaldehyde |
|---|---|
| PubChem CID | 167400253 |
| Molecular Formula | C31H32F2N6O2 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 3-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-1H-indole-4-carbaldehyde |
| SMILES | O=Cc1cccc2[nH]cc(-c3c(F)cc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C31H32F2N6O2/c32-23-12-21-28(27(33)26(23)22-13-34-24-5-1-4-18(16-40)25(22)24)36-30(41-17-31-8-2-10-39(31)11-3-9-31)37-29(21)38-14-19-6-7-20(15-38)35-19/h1,4-5,12-13,16,19-20,34-35H,2-3,6-11,14-15,17H2/t19-,20+ |
| InChIKey | PJRHLTLGJUYKHZ-BGYRXZFFSA-N |
| XLogP | 4.82 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|