C23H27ClF2N6O2 — CID 164534445
7-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one (PubChem CID 164534445) has the molecular formula C23H27ClF2N6O2 and a molecular weight of 492.96 g/mol. Its IUPAC name is 7-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one.
| Compound Name | 7-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 164534445 |
| Molecular Formula | C23H27ClF2N6O2 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 7-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCCN(c3nc(OC[C@@]45CCCN4C[C@H](F)C5)nc4c(F)c(Cl)ncc34)C2)CN1 |
| InChI | InChI=1S/C23H27ClF2N6O2/c24-19-17(26)18-15(9-27-19)20(31-5-1-3-22(12-31)8-16(33)28-11-22)30-21(29-18)34-13-23-4-2-6-32(23)10-14(25)7-23/h9,14H,1-8,10-13H2,(H,28,33)/t14-,22?,23+/m1/s1 |
| InChIKey | GZWKAYFAKICBFP-MMPPVAAOSA-N |
| XLogP | 2.88 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|