C22H26ClF2N5O2 — CID 170714978
(1R,5R,6R)-3-[7-chloro-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol (PubChem CID 170714978) has the molecular formula C22H26ClF2N5O2 and a molecular weight of 465.93 g/mol. Its IUPAC name is (1R,5R,6R)-3-[7-chloro-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol.
| Compound Name | (1R,5R,6R)-3-[7-chloro-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 170714978 |
| Molecular Formula | C22H26ClF2N5O2 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (1R,5R,6R)-3-[7-chloro-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol |
| SMILES | O[C@@H]1C[C@H]2C[C@@H]1CN(c1nc(OCC34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)ncc13)C2 |
| InChI | InChI=1S/C22H26ClF2N5O2/c23-19-17(25)18-15(7-26-19)20(29-8-12-4-13(9-29)16(31)5-12)28-21(27-18)32-11-22-2-1-3-30(22)10-14(24)6-22/h7,12-14,16,31H,1-6,8-11H2/t12-,13-,14-,16-,22?/m1/s1 |
| InChIKey | IEMATVWSFQBFCT-PTHNENQFSA-N |
| XLogP | 2.98 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|