C22H25ClF2N6O — CID 167468791
1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile (PubChem CID 167468791) has the molecular formula C22H25ClF2N6O and a molecular weight of 462.93 g/mol. Its IUPAC name is 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile.
| Compound Name | 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
|---|---|
| PubChem CID | 167468791 |
| Molecular Formula | C22H25ClF2N6O |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
| SMILES | N#CC1CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)ncc23)CC1 |
| InChI | InChI=1S/C22H25ClF2N6O/c23-19-17(25)18-16(11-27-19)20(30-6-1-3-14(10-26)4-8-30)29-21(28-18)32-13-22-5-2-7-31(22)12-15(24)9-22/h11,14-15H,1-9,12-13H2/t14?,15-,22+/m1/s1 |
| InChIKey | QILVDXSQENGEJN-YHYOAMKMSA-N |
| XLogP | 3.90 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|