C33H34F2N6O2 — CID 166157531
2-[1-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]azepan-4-yl]acetonitrile (PubChem CID 166157531) has the molecular formula C33H34F2N6O2 and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-[1-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]azepan-4-yl]acetonitrile.
| Compound Name | 2-[1-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]azepan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 166157531 |
| Molecular Formula | C33H34F2N6O2 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 2-[1-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]azepan-4-yl]acetonitrile |
| SMILES | N#CCC1CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cc(O)cc5ccccc45)ncc23)CC1 |
| InChI | InChI=1S/C33H34F2N6O2/c34-23-17-33(10-4-13-41(33)19-23)20-43-32-38-30-27(31(39-32)40-12-3-5-21(8-11-36)9-14-40)18-37-29(28(30)35)26-16-24(42)15-22-6-1-2-7-25(22)26/h1-2,6-7,15-16,18,21,23,42H,3-5,8-10,12-14,17,19-20H2/t21?,23-,33+/m1/s1 |
| InChIKey | JWLCLUPEMIZHLD-WVXPHISTSA-N |
| XLogP | 6.17 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |