C23H28ClFN6O2 — CID 164535393
7-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one (PubChem CID 164535393) has the molecular formula C23H28ClFN6O2 and a molecular weight of 474.97 g/mol. Its IUPAC name is 7-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one.
| Compound Name | 7-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 164535393 |
| Molecular Formula | C23H28ClFN6O2 |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 7-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,7-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(Cl)ncc34)C2)CN1 |
| InChI | InChI=1S/C23H28ClFN6O2/c24-19-17(25)18-15(11-26-19)20(30-7-1-4-22(13-30)10-16(32)27-12-22)29-21(28-18)33-14-23-5-2-8-31(23)9-3-6-23/h11H,1-10,12-14H2,(H,27,32) |
| InChIKey | POOXMWHOUUBJFR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|