C27H33FN8O3 — CID 177373443
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,6-dimethoxypyridazin-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 177373443) has the molecular formula C27H33FN8O3 and a molecular weight of 536.61 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,6-dimethoxypyridazin-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,6-dimethoxypyridazin-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 177373443 |
| Molecular Formula | C27H33FN8O3 |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,6-dimethoxypyridazin-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | COc1cc(-c2ncc3c(N4CC5CCC(C4)N5)nc(OCC45CCCN4CCC5)nc3c2F)c(OC)nn1 |
| InChI | InChI=1S/C27H33FN8O3/c1-37-20-11-18(25(38-2)34-33-20)22-21(28)23-19(12-29-22)24(35-13-16-5-6-17(14-35)30-16)32-26(31-23)39-15-27-7-3-9-36(27)10-4-8-27/h11-12,16-17,30H,3-10,13-15H2,1-2H3 |
| InChIKey | VBIREJGJKXWGFH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |