C32H35FN6O2 — CID 177373450
4-[4-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 177373450) has the molecular formula C32H35FN6O2 and a molecular weight of 554.67 g/mol. Its IUPAC name is 4-[4-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[4-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 177373450 |
| Molecular Formula | C32H35FN6O2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 4-[4-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4CC5CCCC(C4)N5)nc(OCC45CCCN4CCC5)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C32H35FN6O2/c33-27-28(25-15-23(40)14-20-6-1-2-9-24(20)25)34-16-26-29(27)36-31(41-19-32-10-4-12-39(32)13-5-11-32)37-30(26)38-17-21-7-3-8-22(18-38)35-21/h1-2,6,9,14-16,21-22,35,40H,3-5,7-8,10-13,17-19H2 |
| InChIKey | GRDZLCUYOJPPRG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |