C30H37FN6O2 — CID 164521480
3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-propan-2-ylphenol (PubChem CID 164521480) has the molecular formula C30H37FN6O2 and a molecular weight of 532.66 g/mol. Its IUPAC name is 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-propan-2-ylphenol.
| Compound Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 164521480 |
| Molecular Formula | C30H37FN6O2 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1ccc(O)cc1-c1ncc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C30H37FN6O2/c1-18(2)22-8-7-21(38)13-23(22)26-25(31)27-24(14-32-26)28(36-15-19-5-6-20(16-36)33-19)35-29(34-27)39-17-30-9-3-11-37(30)12-4-10-30/h7-8,13-14,18-20,33,38H,3-6,9-12,15-17H2,1-2H3/t19-,20+ |
| InChIKey | IFBPJVRVAXGZLF-BGYRXZFFSA-N |
| XLogP | 4.61 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |