C29H31F4N5O2 — CID 167679636
3-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)phenol (PubChem CID 167679636) has the molecular formula C29H31F4N5O2 and a molecular weight of 557.59 g/mol. Its IUPAC name is 3-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)phenol.
| Compound Name | 3-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 167679636 |
| Molecular Formula | C29H31F4N5O2 |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 3-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C(F)(F)F)c(-c2ncc3c(N4CC5CCC(C5)C4)nc(OCC45CCCN4CCC5)nc3c2F)c1 |
| InChI | InChI=1S/C29H31F4N5O2/c30-23-24(20-12-19(39)5-6-22(20)29(31,32)33)34-13-21-25(23)35-27(40-16-28-7-1-9-38(28)10-2-8-28)36-26(21)37-14-17-3-4-18(11-17)15-37/h5-6,12-13,17-18,39H,1-4,7-11,14-16H2 |
| InChIKey | XWODDHVWPMRFMJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |