C29H35FN6O2 — CID 164521909
3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-ethylphenol (PubChem CID 164521909) has the molecular formula C29H35FN6O2 and a molecular weight of 518.64 g/mol. Its IUPAC name is 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-ethylphenol.
| Compound Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-ethylphenol |
|---|---|
| PubChem CID | 164521909 |
| Molecular Formula | C29H35FN6O2 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-ethylphenol |
| SMILES | CCc1ccc(O)cc1-c1ncc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C29H35FN6O2/c1-2-18-5-8-21(37)13-22(18)25-24(30)26-23(14-31-25)27(35-15-19-6-7-20(16-35)32-19)34-28(33-26)38-17-29-9-3-11-36(29)12-4-10-29/h5,8,13-14,19-20,32,37H,2-4,6-7,9-12,15-17H2,1H3/t19-,20+ |
| InChIKey | ACIVUPVWQIBTFI-BGYRXZFFSA-N |
| XLogP | 4.05 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |