C23H31ClFN5O — CID 177329915
7-chloro-N-(3-cyclobutylpropyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-methylpyrido[4,3-d]pyrimidin-4-amine (PubChem CID 177329915) has the molecular formula C23H31ClFN5O and a molecular weight of 447.99 g/mol. Its IUPAC name is 7-chloro-N-(3-cyclobutylpropyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-methylpyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-N-(3-cyclobutylpropyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-methylpyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 177329915 |
| Molecular Formula | C23H31ClFN5O |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 7-chloro-N-(3-cyclobutylpropyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-methylpyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CN(CCCC1CCC1)c1nc(OCC23CCCN2CCC3)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C23H31ClFN5O/c1-29(11-3-8-16-6-2-7-16)21-17-14-26-20(24)18(25)19(17)27-22(28-21)31-15-23-9-4-12-30(23)13-5-10-23/h14,16H,2-13,15H2,1H3 |
| InChIKey | VBIOPIFBURPRQB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|