C17H18Cl2F3N5O2 — CID 167294101
tert-butyl N-[1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl]carbamate (PubChem CID 167294101) has the molecular formula C17H18Cl2F3N5O2 and a molecular weight of 452.26 g/mol. Its IUPAC name is tert-butyl N-[1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 167294101 |
| Molecular Formula | C17H18Cl2F3N5O2 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | tert-butyl N-[1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2nc(Cl)nc3c(F)c(Cl)ncc23)CC(F)(F)C1 |
| InChI | InChI=1S/C17H18Cl2F3N5O2/c1-16(2,3)29-15(28)24-8-4-17(21,22)7-27(6-8)13-9-5-23-12(18)10(20)11(9)25-14(19)26-13/h5,8H,4,6-7H2,1-3H3,(H,24,28) |
| InChIKey | GKGKZGGIWZTISA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|