C18H20Cl2FN5O2 — CID 168957588
tert-butyl (3aS,6aR)-2-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 168957588) has the molecular formula C18H20Cl2FN5O2 and a molecular weight of 428.30 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-2-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-2-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 168957588 |
| Molecular Formula | C18H20Cl2FN5O2 |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | tert-butyl (3aS,6aR)-2-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(c3nc(Cl)nc4c(F)c(Cl)ncc34)C[C@@H]2C1 |
| InChI | InChI=1S/C18H20Cl2FN5O2/c1-18(2,3)28-17(27)26-7-9-5-25(6-10(9)8-26)15-11-4-22-14(19)12(21)13(11)23-16(20)24-15/h4,9-10H,5-8H2,1-3H3/t9-,10+ |
| InChIKey | VWHZRQCRCSJIIV-AOOOYVTPSA-N |
| XLogP | 3.77 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|