C18H18Cl2FN5O2 — CID 163289272
tert-butyl 4-(2,7-dichloro-3-cyano-8-fluoro-1,6-naphthyridin-4-yl)piperazine-1-carboxylate (PubChem CID 163289272) has the molecular formula C18H18Cl2FN5O2 and a molecular weight of 426.28 g/mol. Its IUPAC name is tert-butyl 4-(2,7-dichloro-3-cyano-8-fluoro-1,6-naphthyridin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,7-dichloro-3-cyano-8-fluoro-1,6-naphthyridin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163289272 |
| Molecular Formula | C18H18Cl2FN5O2 |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | tert-butyl 4-(2,7-dichloro-3-cyano-8-fluoro-1,6-naphthyridin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(C#N)c(Cl)nc3c(F)c(Cl)ncc23)CC1 |
| InChI | InChI=1S/C18H18Cl2FN5O2/c1-18(2,3)28-17(27)26-6-4-25(5-7-26)14-10(8-22)15(19)24-13-11(14)9-23-16(20)12(13)21/h9H,4-7H2,1-3H3 |
| InChIKey | OMOUJVVCKGCADV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|