C25H28F2N6O4 — CID 154644172
acetonitrile;tert-butyl 4-[8-fluoro-7-(2-fluoro-6-hydroperoxyphenyl)-2-methylpyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 154644172) has the molecular formula C25H28F2N6O4 and a molecular weight of 514.53 g/mol. Its IUPAC name is acetonitrile;tert-butyl 4-[8-fluoro-7-(2-fluoro-6-hydroperoxyphenyl)-2-methylpyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | acetonitrile;tert-butyl 4-[8-fluoro-7-(2-fluoro-6-hydroperoxyphenyl)-2-methylpyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154644172 |
| Molecular Formula | C25H28F2N6O4 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | acetonitrile;tert-butyl 4-[8-fluoro-7-(2-fluoro-6-hydroperoxyphenyl)-2-methylpyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CC#N.Cc1nc(N2CCN(C(=O)OC(C)(C)C)CC2)c2cnc(-c3c(F)cccc3OO)c(F)c2n1 |
| InChI | InChI=1S/C23H25F2N5O4.C2H3N/c1-13-27-19-14(12-26-20(18(19)25)17-15(24)6-5-7-16(17)34-32)21(28-13)29-8-10-30(11-9-29)22(31)33-23(2,3)4;1-2-3/h5-7,12,32H,8-11H2,1-4H3;1H3 |
| InChIKey | GRSMZUQSJRLNFQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|