C16H18Cl2FN5O2 — CID 171108310
tert-butyl N-[(3S)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 171108310) has the molecular formula C16H18Cl2FN5O2 and a molecular weight of 402.26 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171108310 |
| Molecular Formula | C16H18Cl2FN5O2 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | tert-butyl N-[(3S)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C16H18Cl2FN5O2/c1-16(2,3)26-15(25)21-8-4-5-24(7-8)13-9-6-20-12(17)10(19)11(9)22-14(18)23-13/h6,8H,4-5,7H2,1-3H3,(H,21,25)/t8-/m0/s1 |
| InChIKey | BEPCSTJRQOVPHC-QMMMGPOBSA-N |
| XLogP | 3.57 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|