C17H20Cl2FN5O3 — CID 168987535
tert-butyl N-[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]carbamate (PubChem CID 168987535) has the molecular formula C17H20Cl2FN5O3 and a molecular weight of 432.28 g/mol. Its IUPAC name is tert-butyl N-[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]carbamate.
| Compound Name | tert-butyl N-[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]carbamate |
|---|---|
| PubChem CID | 168987535 |
| Molecular Formula | C17H20Cl2FN5O3 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | tert-butyl N-[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1COCCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C17H20Cl2FN5O3/c1-17(2,3)28-16(26)22-9-7-25(4-5-27-8-9)14-10-6-21-13(18)11(20)12(10)23-15(19)24-14/h6,9H,4-5,7-8H2,1-3H3,(H,22,26) |
| InChIKey | GSLSGVGYFIYVGG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|