C14H19ClFN3O3 — CID 139405218
tert-butyl N-(5-chloro-3-fluoro-2-morpholin-4-yl-4-pyridinyl)carbamate (PubChem CID 139405218) has the molecular formula C14H19ClFN3O3 and a molecular weight of 331.78 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-3-fluoro-2-morpholin-4-yl-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-3-fluoro-2-morpholin-4-yl-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 139405218 |
| Molecular Formula | C14H19ClFN3O3 |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | tert-butyl N-(5-chloro-3-fluoro-2-morpholin-4-yl-4-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(Cl)cnc(N2CCOCC2)c1F |
| InChI | InChI=1S/C14H19ClFN3O3/c1-14(2,3)22-13(20)18-11-9(15)8-17-12(10(11)16)19-4-6-21-7-5-19/h8H,4-7H2,1-3H3,(H,17,18,20) |
| InChIKey | PTEYUAATCOPIAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |