C20H26N4O3 — CID 113021128
tert-butyl N-[6-(2-morpholin-4-ylanilino)-3-pyridinyl]carbamate (PubChem CID 113021128) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-[6-(2-morpholin-4-ylanilino)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(2-morpholin-4-ylanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113021128 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl N-[6-(2-morpholin-4-ylanilino)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Nc2ccccc2N2CCOCC2)nc1 |
| InChI | InChI=1S/C20H26N4O3/c1-20(2,3)27-19(25)22-15-8-9-18(21-14-15)23-16-6-4-5-7-17(16)24-10-12-26-13-11-24/h4-9,14H,10-13H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | BAPFGUNXYGNKGU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |