C15H22ClFN4O2 — CID 139405648
tert-butyl N-[5-chloro-3-fluoro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]carbamate (PubChem CID 139405648) has the molecular formula C15H22ClFN4O2 and a molecular weight of 344.82 g/mol. Its IUPAC name is tert-butyl N-[5-chloro-3-fluoro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-chloro-3-fluoro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 139405648 |
| Molecular Formula | C15H22ClFN4O2 |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | tert-butyl N-[5-chloro-3-fluoro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]carbamate |
| SMILES | CN1CCN(c2ncc(Cl)c(NC(=O)OC(C)(C)C)c2F)CC1 |
| InChI | InChI=1S/C15H22ClFN4O2/c1-15(2,3)23-14(22)19-12-10(16)9-18-13(11(12)17)21-7-5-20(4)6-8-21/h9H,5-8H2,1-4H3,(H,18,19,22) |
| InChIKey | JZOQVGHMQCPMOE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |