C23H35ClN4O4 — CID 90851000
tert-butyl N-[4-[[3-chloro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamoyl]oxan-4-yl]carbamate (PubChem CID 90851000) has the molecular formula C23H35ClN4O4 and a molecular weight of 467.01 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-chloro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamoyl]oxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-chloro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamoyl]oxan-4-yl]carbamate |
|---|---|
| PubChem CID | 90851000 |
| Molecular Formula | C23H35ClN4O4 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | tert-butyl N-[4-[[3-chloro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamoyl]oxan-4-yl]carbamate |
| SMILES | CN1CCCN(c2ccc(NC(=O)C3(NC(=O)OC(C)(C)C)CCOCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H35ClN4O4/c1-22(2,3)32-21(30)26-23(8-14-31-15-9-23)20(29)25-17-6-7-19(18(24)16-17)28-11-5-10-27(4)12-13-28/h6-7,16H,5,8-15H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | IZSDHNSYLXUOKV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|