C22H30ClN3O5 — CID 69054934
tert-butyl 2-amino-1-[[3-chloro-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 69054934) has the molecular formula C22H30ClN3O5 and a molecular weight of 451.95 g/mol. Its IUPAC name is tert-butyl 2-amino-1-[[3-chloro-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 2-amino-1-[[3-chloro-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 69054934 |
| Molecular Formula | C22H30ClN3O5 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | tert-butyl 2-amino-1-[[3-chloro-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)Nc2ccc(N3CCOCC3=O)c(Cl)c2)CCCCC1N |
| InChI | InChI=1S/C22H30ClN3O5/c1-21(2,3)31-20(29)22(9-5-4-6-17(22)24)19(28)25-14-7-8-16(15(23)12-14)26-10-11-30-13-18(26)27/h7-8,12,17H,4-6,9-11,13,24H2,1-3H3,(H,25,28) |
| InChIKey | FTFHUIVKUDCXLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|