C21H31N3O6 — CID 69052951
tert-butyl (2R)-2-[amino(methoxy)methyl]-2-methyl-3-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-oxopropanoate (PubChem CID 69052951) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is tert-butyl (2R)-2-[amino(methoxy)methyl]-2-methyl-3-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-oxopropanoate.
| Compound Name | tert-butyl (2R)-2-[amino(methoxy)methyl]-2-methyl-3-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69052951 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | tert-butyl (2R)-2-[amino(methoxy)methyl]-2-methyl-3-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-oxopropanoate |
| SMILES | COC(N)[C@](C)(C(=O)Nc1ccc(N2CCOCC2=O)c(C)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O6/c1-13-11-14(7-8-15(13)24-9-10-29-12-16(24)25)23-18(26)21(5,17(22)28-6)19(27)30-20(2,3)4/h7-8,11,17H,9-10,12,22H2,1-6H3,(H,23,26)/t17?,21-/m1/s1 |
| InChIKey | VNSNZHMDJMSUIO-FBLFFUNLSA-N |
| XLogP | 1.58 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|