C26H33ClN4O6S — CID 68886814
tert-butyl N-[4-[(5-chlorothiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentyl]carbamate (PubChem CID 68886814) has the molecular formula C26H33ClN4O6S and a molecular weight of 565.09 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-chlorothiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-chlorothiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 68886814 |
| Molecular Formula | C26H33ClN4O6S |
| Molecular Weight | 565.09 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | tert-butyl N-[4-[(5-chlorothiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(CCCNC(=O)OC(C)(C)C)NC(=O)c2ccc(Cl)s2)ccc1N1CCOCC1=O |
| InChI | InChI=1S/C26H33ClN4O6S/c1-16-14-17(7-8-19(16)31-12-13-36-15-22(31)32)29-23(33)18(30-24(34)20-9-10-21(27)38-20)6-5-11-28-25(35)37-26(2,3)4/h7-10,14,18H,5-6,11-13,15H2,1-4H3,(H,28,35)(H,29,33)(H,30,34) |
| InChIKey | DUAMBQYLICRRHR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|