C23H26N3O7PS — CID 11511934
N-[3-dimethoxyphosphoryl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide (PubChem CID 11511934) has the molecular formula C23H26N3O7PS and a molecular weight of 519.52 g/mol. Its IUPAC name is N-[3-dimethoxyphosphoryl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide.
| Compound Name | N-[3-dimethoxyphosphoryl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 11511934 |
| Molecular Formula | C23H26N3O7PS |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[3-dimethoxyphosphoryl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide |
| SMILES | C#Cc1ccc(C(=O)NC(CP(=O)(OC)OC)C(=O)Nc2ccc(N3CCOCC3=O)c(C)c2)s1 |
| InChI | InChI=1S/C23H26N3O7PS/c1-5-17-7-9-20(35-17)23(29)25-18(14-34(30,31-3)32-4)22(28)24-16-6-8-19(15(2)12-16)26-10-11-33-13-21(26)27/h1,6-9,12,18H,10-11,13-14H2,2-4H3,(H,24,28)(H,25,29) |
| InChIKey | FKQNPAGPKBMGEG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|