C21H19ClIN3O5S — CID 89260569
N-[(2S)-1-[3-chloro-4-(3-oxomorpholin-4-yl)anilino]-4-hydroxy-2-iodo-1-oxobutan-2-yl]-5-ethynylthiophene-2-carboxamide (PubChem CID 89260569) has the molecular formula C21H19ClIN3O5S and a molecular weight of 587.82 g/mol. Its IUPAC name is N-[(2S)-1-[3-chloro-4-(3-oxomorpholin-4-yl)anilino]-4-hydroxy-2-iodo-1-oxobutan-2-yl]-5-ethynylthiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-[3-chloro-4-(3-oxomorpholin-4-yl)anilino]-4-hydroxy-2-iodo-1-oxobutan-2-yl]-5-ethynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 89260569 |
| Molecular Formula | C21H19ClIN3O5S |
| Molecular Weight | 587.82 g/mol |
| Exact Mass | 586.98 |
| IUPAC Name | N-[(2S)-1-[3-chloro-4-(3-oxomorpholin-4-yl)anilino]-4-hydroxy-2-iodo-1-oxobutan-2-yl]-5-ethynylthiophene-2-carboxamide |
| SMILES | C#Cc1ccc(C(=O)N[C@](I)(CCO)C(=O)Nc2ccc(N3CCOCC3=O)c(Cl)c2)s1 |
| InChI | InChI=1S/C21H19ClIN3O5S/c1-2-14-4-6-17(32-14)19(29)25-21(23,7-9-27)20(30)24-13-3-5-16(15(22)11-13)26-8-10-31-12-18(26)28/h1,3-6,11,27H,7-10,12H2,(H,24,30)(H,25,29)/t21-/m1/s1 |
| InChIKey | KTIJYCNHBRDHMF-OAQYLSRUSA-N |
| XLogP | 2.63 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|