C22H21N3O6S2 — CID 11663123
5-ethynyl-N-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1,1-dioxothietan-3-yl]thiophene-2-carboxamide (PubChem CID 11663123) has the molecular formula C22H21N3O6S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 5-ethynyl-N-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1,1-dioxothietan-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-ethynyl-N-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1,1-dioxothietan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11663123 |
| Molecular Formula | C22H21N3O6S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 5-ethynyl-N-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1,1-dioxothietan-3-yl]thiophene-2-carboxamide |
| SMILES | C#Cc1ccc(C(=O)NC2(C(=O)Nc3ccc(N4CCOCC4=O)c(C)c3)CS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C22H21N3O6S2/c1-3-16-5-7-18(32-16)20(27)24-22(12-33(29,30)13-22)21(28)23-15-4-6-17(14(2)10-15)25-8-9-31-11-19(25)26/h1,4-7,10H,8-9,11-13H2,2H3,(H,23,28)(H,24,27) |
| InChIKey | XWURJUPIIBAXDG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|