C21H23BrN4O3S — CID 69055172
5-bromo-N-[1-[[4-(3-iminomorpholin-4-yl)-3-methylphenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide (PubChem CID 69055172) has the molecular formula C21H23BrN4O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 5-bromo-N-[1-[[4-(3-iminomorpholin-4-yl)-3-methylphenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-[[4-(3-iminomorpholin-4-yl)-3-methylphenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 69055172 |
| Molecular Formula | C21H23BrN4O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 5-bromo-N-[1-[[4-(3-iminomorpholin-4-yl)-3-methylphenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C1\COCCN1c1ccc(NC(=O)C2(NC(=O)c3ccc(Br)s3)CCC2)cc1C |
| InChI | InChI=1S/C21H23BrN4O3S/c1-13-11-14(3-4-15(13)26-9-10-29-12-18(26)23)24-20(28)21(7-2-8-21)25-19(27)16-5-6-17(22)30-16/h3-6,11,23H,2,7-10,12H2,1H3,(H,24,28)(H,25,27)/b23-18+ |
| InChIKey | WZSJLHIEMTWZAJ-PTGBLXJZSA-N |
| XLogP | 3.92 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|