C21H22BrN5O5S — CID 69053534
5-bromo-N-[1-[[3-methyl-4-(3-nitroiminomorpholin-4-yl)phenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide (PubChem CID 69053534) has the molecular formula C21H22BrN5O5S and a molecular weight of 536.41 g/mol. Its IUPAC name is 5-bromo-N-[1-[[3-methyl-4-(3-nitroiminomorpholin-4-yl)phenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-[[3-methyl-4-(3-nitroiminomorpholin-4-yl)phenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 69053534 |
| Molecular Formula | C21H22BrN5O5S |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 5-bromo-N-[1-[[3-methyl-4-(3-nitroiminomorpholin-4-yl)phenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(NC(=O)c3ccc(Br)s3)CCC2)ccc1N1CCOCC1=N[N+](=O)[O-] |
| InChI | InChI=1S/C21H22BrN5O5S/c1-13-11-14(3-4-15(13)26-9-10-32-12-18(26)25-27(30)31)23-20(29)21(7-2-8-21)24-19(28)16-5-6-17(22)33-16/h3-6,11H,2,7-10,12H2,1H3,(H,23,29)(H,24,28) |
| InChIKey | JRSLYBQOPLWVTL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|