C23H24BrN5O5S — CID 87846814
(5-bromothiophen-2-yl) N-[3-[[4-(5-cyanoimino-1,4-oxazepan-4-yl)-3-methylphenyl]carbamoyl]oxolan-3-yl]carbamate (PubChem CID 87846814) has the molecular formula C23H24BrN5O5S and a molecular weight of 562.45 g/mol. Its IUPAC name is (5-bromothiophen-2-yl) N-[3-[[4-(5-cyanoimino-1,4-oxazepan-4-yl)-3-methylphenyl]carbamoyl]oxolan-3-yl]carbamate.
| Compound Name | (5-bromothiophen-2-yl) N-[3-[[4-(5-cyanoimino-1,4-oxazepan-4-yl)-3-methylphenyl]carbamoyl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 87846814 |
| Molecular Formula | C23H24BrN5O5S |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | (5-bromothiophen-2-yl) N-[3-[[4-(5-cyanoimino-1,4-oxazepan-4-yl)-3-methylphenyl]carbamoyl]oxolan-3-yl]carbamate |
| SMILES | Cc1cc(NC(=O)C2(NC(=O)Oc3ccc(Br)s3)CCOC2)ccc1N1CCOCC/C1=N\C#N |
| InChI | InChI=1S/C23H24BrN5O5S/c1-15-12-16(2-3-17(15)29-8-11-32-9-6-19(29)26-14-25)27-21(30)23(7-10-33-13-23)28-22(31)34-20-5-4-18(24)35-20/h2-5,12H,6-11,13H2,1H3,(H,27,30)(H,28,31)/b26-19+ |
| InChIKey | ZODVVFHGDWLTTM-LGUFXXKBSA-N |
| XLogP | 3.81 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|