C24H28BrN5O5S — CID 143713778
(3S)-3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-cyanoimino-1,4-oxazepan-4-yl)phenyl]oxolane-3-carboxamide;methoxymethane (PubChem CID 143713778) has the molecular formula C24H28BrN5O5S and a molecular weight of 578.49 g/mol. Its IUPAC name is (3S)-3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-cyanoimino-1,4-oxazepan-4-yl)phenyl]oxolane-3-carboxamide;methoxymethane.
| Compound Name | (3S)-3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-cyanoimino-1,4-oxazepan-4-yl)phenyl]oxolane-3-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 143713778 |
| Molecular Formula | C24H28BrN5O5S |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | (3S)-3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-cyanoimino-1,4-oxazepan-4-yl)phenyl]oxolane-3-carboxamide;methoxymethane |
| SMILES | COC.N#C/N=C1\CCOCCN1c1ccc(NC(=O)[C@]2(NC(=O)c3ccc(Br)s3)CCOC2)cc1 |
| InChI | InChI=1S/C22H22BrN5O4S.C2H6O/c23-18-6-5-17(33-18)20(29)27-22(8-11-32-13-22)21(30)26-15-1-3-16(4-2-15)28-9-12-31-10-7-19(28)25-14-24;1-3-2/h1-6H,7-13H2,(H,26,30)(H,27,29);1-2H3/b25-19+;/t22-;/m0./s1 |
| InChIKey | XJKZWYFGDPEVSO-PZMJPHPISA-N |
| XLogP | 3.41 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|