C22H25BrN4O4S — CID 69053523
3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-imino-1,4-oxazepan-4-yl)-3-methylphenyl]oxolane-3-carboxamide (PubChem CID 69053523) has the molecular formula C22H25BrN4O4S and a molecular weight of 521.44 g/mol. Its IUPAC name is 3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-imino-1,4-oxazepan-4-yl)-3-methylphenyl]oxolane-3-carboxamide.
| Compound Name | 3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-imino-1,4-oxazepan-4-yl)-3-methylphenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 69053523 |
| Molecular Formula | C22H25BrN4O4S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 3-[(5-bromothiophene-2-carbonyl)amino]-N-[4-(5-imino-1,4-oxazepan-4-yl)-3-methylphenyl]oxolane-3-carboxamide |
| SMILES | [H]/N=C1\CCOCCN1c1ccc(NC(=O)C2(NC(=O)c3ccc(Br)s3)CCOC2)cc1C |
| InChI | InChI=1S/C22H25BrN4O4S/c1-14-12-15(2-3-16(14)27-8-11-30-9-6-19(27)24)25-21(29)22(7-10-31-13-22)26-20(28)17-4-5-18(23)32-17/h2-5,12,24H,6-11,13H2,1H3,(H,25,29)(H,26,28)/b24-19+ |
| InChIKey | FSOOGNCHDZKHLE-LYBHJNIJSA-N |
| XLogP | 3.55 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|