C21H22BrN3O5S2 — CID 90820046
(5-bromothiophen-2-yl) N-[3-[[3-methyl-4-(3-sulfanylidenemorpholin-4-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate (PubChem CID 90820046) has the molecular formula C21H22BrN3O5S2 and a molecular weight of 540.46 g/mol. Its IUPAC name is (5-bromothiophen-2-yl) N-[3-[[3-methyl-4-(3-sulfanylidenemorpholin-4-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate.
| Compound Name | (5-bromothiophen-2-yl) N-[3-[[3-methyl-4-(3-sulfanylidenemorpholin-4-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 90820046 |
| Molecular Formula | C21H22BrN3O5S2 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | (5-bromothiophen-2-yl) N-[3-[[3-methyl-4-(3-sulfanylidenemorpholin-4-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
| SMILES | Cc1cc(NC(=O)C2(NC(=O)Oc3ccc(Br)s3)CCOC2)ccc1N1CCOCC1=S |
| InChI | InChI=1S/C21H22BrN3O5S2/c1-13-10-14(2-3-15(13)25-7-9-28-11-17(25)31)23-19(26)21(6-8-29-12-21)24-20(27)30-18-5-4-16(22)32-18/h2-5,10H,6-9,11-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | YNLKXKHWQSCTNW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|