C23H23N3O5S — CID 87792575
(5-ethynylthiophen-2-yl) N-[3-[[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate (PubChem CID 87792575) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is (5-ethynylthiophen-2-yl) N-[3-[[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate.
| Compound Name | (5-ethynylthiophen-2-yl) N-[3-[[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 87792575 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (5-ethynylthiophen-2-yl) N-[3-[[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
| SMILES | C#Cc1ccc(OC(=O)NC2(C(=O)Nc3ccc(N4CCCC4=O)c(C)c3)CCOC2)s1 |
| InChI | InChI=1S/C23H23N3O5S/c1-3-17-7-9-20(32-17)31-22(29)25-23(10-12-30-14-23)21(28)24-16-6-8-18(15(2)13-16)26-11-4-5-19(26)27/h1,6-9,13H,4-5,10-12,14H2,2H3,(H,24,28)(H,25,29) |
| InChIKey | OIEUWLUCRJYWHY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|