C21H22BrClN4O4S — CID 91525158
(5-bromothiophen-2-yl) N-[3-[[3-chloro-4-(2-iminopiperidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate (PubChem CID 91525158) has the molecular formula C21H22BrClN4O4S and a molecular weight of 541.86 g/mol. Its IUPAC name is (5-bromothiophen-2-yl) N-[3-[[3-chloro-4-(2-iminopiperidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate.
| Compound Name | (5-bromothiophen-2-yl) N-[3-[[3-chloro-4-(2-iminopiperidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 91525158 |
| Molecular Formula | C21H22BrClN4O4S |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | (5-bromothiophen-2-yl) N-[3-[[3-chloro-4-(2-iminopiperidin-1-yl)phenyl]carbamoyl]oxolan-3-yl]carbamate |
| SMILES | [H]/N=C1\CCCCN1c1ccc(NC(=O)C2(NC(=O)Oc3ccc(Br)s3)CCOC2)cc1Cl |
| InChI | InChI=1S/C21H22BrClN4O4S/c22-16-6-7-18(32-16)31-20(29)26-21(8-10-30-12-21)19(28)25-13-4-5-15(14(23)11-13)27-9-2-1-3-17(27)24/h4-7,11,24H,1-3,8-10,12H2,(H,25,28)(H,26,29)/b24-17+ |
| InChIKey | QUMCKDMDUXJLAZ-JJIBRWJFSA-N |
| XLogP | 5.02 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|