C16H23N2O6P — CID 87236349
3-dimethoxyphosphoryl-2-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide (PubChem CID 87236349) has the molecular formula C16H23N2O6P and a molecular weight of 370.34 g/mol. Its IUPAC name is 3-dimethoxyphosphoryl-2-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide.
| Compound Name | 3-dimethoxyphosphoryl-2-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 87236349 |
| Molecular Formula | C16H23N2O6P |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-dimethoxyphosphoryl-2-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide |
| SMILES | COP(=O)(CC(C(N)=O)c1ccc(N2CCOCC2=O)c(C)c1)OC |
| InChI | InChI=1S/C16H23N2O6P/c1-11-8-12(13(16(17)20)10-25(21,22-2)23-3)4-5-14(11)18-6-7-24-9-15(18)19/h4-5,8,13H,6-7,9-10H2,1-3H3,(H2,17,20) |
| InChIKey | KTZDETYYRCUJHT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|