C16H24N3O2+ — CID 69466856
4-[4-(3-amino-1-methylpyrrolidin-1-ium-1-yl)-2-methylphenyl]morpholin-3-one (PubChem CID 69466856) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-[4-(3-amino-1-methylpyrrolidin-1-ium-1-yl)-2-methylphenyl]morpholin-3-one.
| Compound Name | 4-[4-(3-amino-1-methylpyrrolidin-1-ium-1-yl)-2-methylphenyl]morpholin-3-one |
|---|---|
| PubChem CID | 69466856 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 4-[4-(3-amino-1-methylpyrrolidin-1-ium-1-yl)-2-methylphenyl]morpholin-3-one |
| SMILES | Cc1cc([N+]2(C)CCC(N)C2)ccc1N1CCOCC1=O |
| InChI | InChI=1S/C16H24N3O2/c1-12-9-14(19(2)7-5-13(17)10-19)3-4-15(12)18-6-8-21-11-16(18)20/h3-4,9,13H,5-8,10-11,17H2,1-2H3/q+1 |
| InChIKey | YXFXFRBHMIZYPK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|