C11H12F2N2O3 — CID 141122127
4-[4-amino-2-(difluoromethoxy)phenyl]morpholin-3-one (PubChem CID 141122127) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is 4-[4-amino-2-(difluoromethoxy)phenyl]morpholin-3-one.
| Compound Name | 4-[4-amino-2-(difluoromethoxy)phenyl]morpholin-3-one |
|---|---|
| PubChem CID | 141122127 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[4-amino-2-(difluoromethoxy)phenyl]morpholin-3-one |
| SMILES | Nc1ccc(N2CCOCC2=O)c(OC(F)F)c1 |
| InChI | InChI=1S/C11H12F2N2O3/c12-11(13)18-9-5-7(14)1-2-8(9)15-3-4-17-6-10(15)16/h1-2,5,11H,3-4,6,14H2 |
| InChIKey | QPBQQDMSVWNAOH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|