C26H34N2O8 — CID 11016587
7,16-bis(2-methoxyphenyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione (PubChem CID 11016587) has the molecular formula C26H34N2O8 and a molecular weight of 502.56 g/mol. Its IUPAC name is 7,16-bis(2-methoxyphenyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione.
| Compound Name | 7,16-bis(2-methoxyphenyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
|---|---|
| PubChem CID | 11016587 |
| Molecular Formula | C26H34N2O8 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 7,16-bis(2-methoxyphenyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
| SMILES | COc1ccccc1N1CCOCCOCCN(c2ccccc2OC)C(=O)COCCOCC1=O |
| InChI | InChI=1S/C26H34N2O8/c1-31-23-9-5-3-7-21(23)27-11-13-33-15-16-34-14-12-28(22-8-4-6-10-24(22)32-2)26(30)20-36-18-17-35-19-25(27)29/h3-10H,11-20H2,1-2H3 |
| InChIKey | DGNNNKNRUNRFBX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |